C13H9BrClF2N3O — CID 103481479
N-(2-bromo-3-chlorophenyl)-3,5-difluoro-4-hydrazinylbenzamide (PubChem CID 103481479) has the molecular formula C13H9BrClF2N3O and a molecular weight of 376.59 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-3,5-difluoro-4-hydrazinylbenzamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-3,5-difluoro-4-hydrazinylbenzamide |
|---|---|
| PubChem CID | 103481479 |
| Molecular Formula | C13H9BrClF2N3O |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-3,5-difluoro-4-hydrazinylbenzamide |
| SMILES | NNc1c(F)cc(C(=O)Nc2cccc(Cl)c2Br)cc1F |
| InChI | InChI=1S/C13H9BrClF2N3O/c14-11-7(15)2-1-3-10(11)19-13(21)6-4-8(16)12(20-18)9(17)5-6/h1-5,20H,18H2,(H,19,21) |
| InChIKey | GZURWEBKBBSENM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|