C13H9BrF3N3O — CID 63186568
N-(5-bromo-2-fluorophenyl)-3,5-difluoro-4-hydrazinylbenzamide (PubChem CID 63186568) has the molecular formula C13H9BrF3N3O and a molecular weight of 360.13 g/mol. Its IUPAC name is N-(5-bromo-2-fluorophenyl)-3,5-difluoro-4-hydrazinylbenzamide.
| Compound Name | N-(5-bromo-2-fluorophenyl)-3,5-difluoro-4-hydrazinylbenzamide |
|---|---|
| PubChem CID | 63186568 |
| Molecular Formula | C13H9BrF3N3O |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-(5-bromo-2-fluorophenyl)-3,5-difluoro-4-hydrazinylbenzamide |
| SMILES | NNc1c(F)cc(C(=O)Nc2cc(Br)ccc2F)cc1F |
| InChI | InChI=1S/C13H9BrF3N3O/c14-7-1-2-8(15)11(5-7)19-13(21)6-3-9(16)12(20-18)10(17)4-6/h1-5,20H,18H2,(H,19,21) |
| InChIKey | INBNYPVKGSJMMM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|