C14H10ClF3N2O — CID 63187023
N-(3-chloro-2-fluorophenyl)-3,5-difluoro-4-(methylamino)benzamide (PubChem CID 63187023) has the molecular formula C14H10ClF3N2O and a molecular weight of 314.69 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-3,5-difluoro-4-(methylamino)benzamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-3,5-difluoro-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 63187023 |
| Molecular Formula | C14H10ClF3N2O |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-3,5-difluoro-4-(methylamino)benzamide |
| SMILES | CNc1c(F)cc(C(=O)Nc2cccc(Cl)c2F)cc1F |
| InChI | InChI=1S/C14H10ClF3N2O/c1-19-13-9(16)5-7(6-10(13)17)14(21)20-11-4-2-3-8(15)12(11)18/h2-6,19H,1H3,(H,20,21) |
| InChIKey | CXQMNPMRWXGUMW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |