C11H5BrCl2FN3O — CID 114038522
N-(4-bromo-3-fluorophenyl)-3,6-dichloropyridazine-4-carboxamide (PubChem CID 114038522) has the molecular formula C11H5BrCl2FN3O and a molecular weight of 364.99 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-3,6-dichloropyridazine-4-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-3,6-dichloropyridazine-4-carboxamide |
|---|---|
| PubChem CID | 114038522 |
| Molecular Formula | C11H5BrCl2FN3O |
| Molecular Weight | 364.99 g/mol |
| Exact Mass | 362.90 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-3,6-dichloropyridazine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(F)c1)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C11H5BrCl2FN3O/c12-7-2-1-5(3-8(7)15)16-11(19)6-4-9(13)17-18-10(6)14/h1-4H,(H,16,19) |
| InChIKey | BWRQRLQFORCALZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.99 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |