C12H10BrFN4O — CID 65435257
N-(4-bromo-3-fluorophenyl)-6-(methylamino)pyridazine-3-carboxamide (PubChem CID 65435257) has the molecular formula C12H10BrFN4O and a molecular weight of 325.14 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-6-(methylamino)pyridazine-3-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-6-(methylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 65435257 |
| Molecular Formula | C12H10BrFN4O |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-6-(methylamino)pyridazine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2ccc(Br)c(F)c2)nn1 |
| InChI | InChI=1S/C12H10BrFN4O/c1-15-11-5-4-10(17-18-11)12(19)16-7-2-3-8(13)9(14)6-7/h2-6H,1H3,(H,15,18)(H,16,19) |
| InChIKey | JQWUYLMYDYQZDI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |