C13H13FN4O — CID 79047301
N-(3-fluoro-5-methylphenyl)-6-(methylamino)pyridazine-3-carboxamide (PubChem CID 79047301) has the molecular formula C13H13FN4O and a molecular weight of 260.27 g/mol. Its IUPAC name is N-(3-fluoro-5-methylphenyl)-6-(methylamino)pyridazine-3-carboxamide.
| Compound Name | N-(3-fluoro-5-methylphenyl)-6-(methylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79047301 |
| Molecular Formula | C13H13FN4O |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(3-fluoro-5-methylphenyl)-6-(methylamino)pyridazine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2cc(C)cc(F)c2)nn1 |
| InChI | InChI=1S/C13H13FN4O/c1-8-5-9(14)7-10(6-8)16-13(19)11-3-4-12(15-2)18-17-11/h3-7H,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | FIMWTNUYKPLZLN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |