C12H12BrN5O — CID 79048080
N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridazine-3-carboxamide (PubChem CID 79048080) has the molecular formula C12H12BrN5O and a molecular weight of 322.17 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridazine-3-carboxamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79048080 |
| Molecular Formula | C12H12BrN5O |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridazine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2ccc(Br)c(C)n2)nn1 |
| InChI | InChI=1S/C12H12BrN5O/c1-7-8(13)3-5-11(15-7)16-12(19)9-4-6-10(14-2)18-17-9/h3-6H,1-2H3,(H,14,18)(H,15,16,19) |
| InChIKey | XARMEFXUOWLFJL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |