C13H13BrN4O — CID 79048918
N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridine-2-carboxamide (PubChem CID 79048918) has the molecular formula C13H13BrN4O and a molecular weight of 321.18 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridine-2-carboxamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 79048918 |
| Molecular Formula | C13H13BrN4O |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-6-(methylamino)pyridine-2-carboxamide |
| SMILES | CNc1cccc(C(=O)Nc2ccc(Br)c(C)n2)n1 |
| InChI | InChI=1S/C13H13BrN4O/c1-8-9(14)6-7-12(16-8)18-13(19)10-4-3-5-11(15-2)17-10/h3-7H,1-2H3,(H,15,17)(H,16,18,19) |
| InChIKey | VEOMKXCYRHKXQG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |