C12H9Cl2N3O2 — CID 6405267
3,6-dichloro-N-(3-methoxyphenyl)pyridazine-4-carboxamide (PubChem CID 6405267) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is 3,6-dichloro-N-(3-methoxyphenyl)pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-(3-methoxyphenyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 6405267 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 3,6-dichloro-N-(3-methoxyphenyl)pyridazine-4-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cc(Cl)nnc2Cl)c1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c1-19-8-4-2-3-7(5-8)15-12(18)9-6-10(13)16-17-11(9)14/h2-6H,1H3,(H,15,18) |
| InChIKey | XDUMITDDSZTFKG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |