C13H8Cl2IN3OS — CID 4504032
3,4-dichloro-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide (PubChem CID 4504032) has the molecular formula C13H8Cl2IN3OS and a molecular weight of 452.10 g/mol. Its IUPAC name is 3,4-dichloro-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4504032 |
| Molecular Formula | C13H8Cl2IN3OS |
| Molecular Weight | 452.10 g/mol |
| Exact Mass | 450.88 |
| IUPAC Name | 3,4-dichloro-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(I)cn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2IN3OS/c14-9-3-1-7(5-10(9)15)12(20)19-13(21)18-11-4-2-8(16)6-17-11/h1-6H,(H2,17,18,19,20,21) |
| InChIKey | ALASLKMYVHQXOF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.10 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|