C15H7Cl2F6NO — CID 134094337
N-[3,5-bis(trifluoromethyl)phenyl]-2,6-dichlorobenzamide (PubChem CID 134094337) has the molecular formula C15H7Cl2F6NO and a molecular weight of 402.12 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2,6-dichlorobenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 134094337 |
| Molecular Formula | C15H7Cl2F6NO |
| Molecular Weight | 402.12 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2,6-dichlorobenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H7Cl2F6NO/c16-10-2-1-3-11(17)12(10)13(25)24-9-5-7(14(18,19)20)4-8(6-9)15(21,22)23/h1-6H,(H,24,25) |
| InChIKey | IFAHXDUMHVIGNW-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.12 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |