C16H7Cl2F6NO3 — CID 2798658
[3,5-bis(trifluoromethyl)phenyl] N-(2,6-dichlorobenzoyl)carbamate (PubChem CID 2798658) has the molecular formula C16H7Cl2F6NO3 and a molecular weight of 446.13 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] N-(2,6-dichlorobenzoyl)carbamate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] N-(2,6-dichlorobenzoyl)carbamate |
|---|---|
| PubChem CID | 2798658 |
| Molecular Formula | C16H7Cl2F6NO3 |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] N-(2,6-dichlorobenzoyl)carbamate |
| SMILES | O=C(NC(=O)c1c(Cl)cccc1Cl)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H7Cl2F6NO3/c17-10-2-1-3-11(18)12(10)13(26)25-14(27)28-9-5-7(15(19,20)21)4-8(6-9)16(22,23)24/h1-6H,(H,25,26,27) |
| InChIKey | JUNALCJJZMGBCW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |