C15H10ClF3N2O3 — CID 19808580
2-chloro-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]carbamoyl]benzamide (PubChem CID 19808580) has the molecular formula C15H10ClF3N2O3 and a molecular weight of 358.70 g/mol. Its IUPAC name is 2-chloro-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]carbamoyl]benzamide.
| Compound Name | 2-chloro-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 19808580 |
| Molecular Formula | C15H10ClF3N2O3 |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-chloro-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(O)cccc1Cl)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10ClF3N2O3/c16-10-2-1-3-11(22)12(10)13(23)21-14(24)20-9-6-4-8(5-7-9)15(17,18)19/h1-7,22H,(H2,20,21,23,24) |
| InChIKey | AIFYOORXONYLBX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |