C14H8Cl2F3NO2 — CID 134151897
4,5-dichloro-2-hydroxy-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 134151897) has the molecular formula C14H8Cl2F3NO2 and a molecular weight of 350.12 g/mol. Its IUPAC name is 4,5-dichloro-2-hydroxy-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4,5-dichloro-2-hydroxy-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 134151897 |
| Molecular Formula | C14H8Cl2F3NO2 |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 4,5-dichloro-2-hydroxy-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cc(Cl)c(Cl)cc1O |
| InChI | InChI=1S/C14H8Cl2F3NO2/c15-10-5-9(12(21)6-11(10)16)13(22)20-8-3-1-7(2-4-8)14(17,18)19/h1-6,21H,(H,20,22) |
| InChIKey | GTKGTEDQYWBEJM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |