C22H14F6N2O3 — CID 155920070
2-hydroxy-1-N,3-N-bis[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 155920070) has the molecular formula C22H14F6N2O3 and a molecular weight of 468.35 g/mol. Its IUPAC name is 2-hydroxy-1-N,3-N-bis[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 2-hydroxy-1-N,3-N-bis[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 155920070 |
| Molecular Formula | C22H14F6N2O3 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-hydroxy-1-N,3-N-bis[4-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cccc(C(=O)Nc2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C22H14F6N2O3/c23-21(24,25)12-4-8-14(9-5-12)29-19(32)16-2-1-3-17(18(16)31)20(33)30-15-10-6-13(7-11-15)22(26,27)28/h1-11,31H,(H,29,32)(H,30,33) |
| InChIKey | AXGWKXBVIACAGE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |