C22H20F3N3O — CID 149266248
N-[4-(2-aminoethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 149266248) has the molecular formula C22H20F3N3O and a molecular weight of 399.42 g/mol. Its IUPAC name is N-[4-(2-aminoethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-(2-aminoethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 149266248 |
| Molecular Formula | C22H20F3N3O |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[4-(2-aminoethylamino)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | NCCNc1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H20F3N3O/c23-22(24,25)16-7-5-15(6-8-16)19-3-1-2-4-20(19)21(29)28-18-11-9-17(10-12-18)27-14-13-26/h1-12,27H,13-14,26H2,(H,28,29) |
| InChIKey | XQEVCCQTISSNNC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |