C27H29F3N3O2+ — CID 2105849
diethyl-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoyl]amino]ethyl]azanium (PubChem CID 2105849) has the molecular formula C27H29F3N3O2+ and a molecular weight of 484.54 g/mol. Its IUPAC name is diethyl-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoyl]amino]ethyl]azanium.
| Compound Name | diethyl-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 2105849 |
| Molecular Formula | C27H29F3N3O2+ |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | diethyl-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoyl]amino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCNC(=O)c1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H28F3N3O2/c1-3-33(4-2)18-17-31-25(34)20-11-15-22(16-12-20)32-26(35)24-8-6-5-7-23(24)19-9-13-21(14-10-19)27(28,29)30/h5-16H,3-4,17-18H2,1-2H3,(H,31,34)(H,32,35)/p+1 |
| InChIKey | VJUCHMDKYBGFJT-UHFFFAOYSA-O |
| XLogP | 4.28 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |