C27H19F3N2O2 — CID 70143092
N-[3-(phenylcarbamoyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 70143092) has the molecular formula C27H19F3N2O2 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-[3-(phenylcarbamoyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[3-(phenylcarbamoyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 70143092 |
| Molecular Formula | C27H19F3N2O2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[3-(phenylcarbamoyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H19F3N2O2/c28-27(29,30)20-15-13-18(14-16-20)23-11-4-5-12-24(23)26(34)32-22-10-6-7-19(17-22)25(33)31-21-8-2-1-3-9-21/h1-17H,(H,31,33)(H,32,34) |
| InChIKey | CUUQSQLWFQYNJN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |