C21H18ClNO3 — CID 70145450
3-[[2-(4-methylphenyl)benzoyl]amino]benzoic acid;hydrochloride (PubChem CID 70145450) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is 3-[[2-(4-methylphenyl)benzoyl]amino]benzoic acid;hydrochloride.
| Compound Name | 3-[[2-(4-methylphenyl)benzoyl]amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 70145450 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[[2-(4-methylphenyl)benzoyl]amino]benzoic acid;hydrochloride |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2cccc(C(=O)O)c2)cc1.Cl |
| InChI | InChI=1S/C21H17NO3.ClH/c1-14-9-11-15(12-10-14)18-7-2-3-8-19(18)20(23)22-17-6-4-5-16(13-17)21(24)25;/h2-13H,1H3,(H,22,23)(H,24,25);1H |
| InChIKey | JHOOUIVEWROQQX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |