C31H26N4O2 — CID 176857902
N-[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 176857902) has the molecular formula C31H26N4O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is N-[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 176857902 |
| Molecular Formula | C31H26N4O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N-[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(-c3cc(NC(=O)c4ccccc4)n(C)n3)cc2)cc1 |
| InChI | InChI=1S/C31H26N4O2/c1-21-12-14-22(15-13-21)26-10-6-7-11-27(26)31(37)32-25-18-16-23(17-19-25)28-20-29(35(2)34-28)33-30(36)24-8-4-3-5-9-24/h3-20H,1-2H3,(H,32,37)(H,33,36) |
| InChIKey | IYYKENYPTYERSQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |