C25H23N5O2 — CID 170596524
N-[3-[4-[[(E,2E)-4-cyano-2-ethylidenepent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide (PubChem CID 170596524) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[3-[4-[[(E,2E)-4-cyano-2-ethylidenepent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide.
| Compound Name | N-[3-[4-[[(E,2E)-4-cyano-2-ethylidenepent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 170596524 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-[3-[4-[[(E,2E)-4-cyano-2-ethylidenepent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide |
| SMILES | C/C=C(\C=C(/C)C#N)C(=O)Nc1ccc(-c2cc(NC(=O)c3ccccc3)n(C)n2)cc1 |
| InChI | InChI=1S/C25H23N5O2/c1-4-18(14-17(2)16-26)24(31)27-21-12-10-19(11-13-21)22-15-23(30(3)29-22)28-25(32)20-8-6-5-7-9-20/h4-15H,1-3H3,(H,27,31)(H,28,32)/b17-14+,18-4+ |
| InChIKey | MDQPUEKUKSDZBV-ROHWBCOBSA-N |
| XLogP | 4.69 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|