C31H27IN4O2 — CID 170596540
N-[3-[4-[[5-[iodo(phenyl)methyl]cyclohexa-1,5-diene-1-carbonyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide (PubChem CID 170596540) has the molecular formula C31H27IN4O2 and a molecular weight of 614.49 g/mol. Its IUPAC name is N-[3-[4-[[5-[iodo(phenyl)methyl]cyclohexa-1,5-diene-1-carbonyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide.
| Compound Name | N-[3-[4-[[5-[iodo(phenyl)methyl]cyclohexa-1,5-diene-1-carbonyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 170596540 |
| Molecular Formula | C31H27IN4O2 |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | N-[3-[4-[[5-[iodo(phenyl)methyl]cyclohexa-1,5-diene-1-carbonyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide |
| SMILES | Cn1nc(-c2ccc(NC(=O)C3=CCCC(C(I)c4ccccc4)=C3)cc2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H27IN4O2/c1-36-28(34-30(37)23-11-6-3-7-12-23)20-27(35-36)21-15-17-26(18-16-21)33-31(38)25-14-8-13-24(19-25)29(32)22-9-4-2-5-10-22/h2-7,9-12,14-20,29H,8,13H2,1H3,(H,33,38)(H,34,37) |
| InChIKey | DQLGDLINESOMAQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|