C30H27N5O4 — CID 170596504
N-[3-[4-[[(Z,2E)-2-ethylidene-3-(4-nitrophenyl)pent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide (PubChem CID 170596504) has the molecular formula C30H27N5O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-[3-[4-[[(Z,2E)-2-ethylidene-3-(4-nitrophenyl)pent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide.
| Compound Name | N-[3-[4-[[(Z,2E)-2-ethylidene-3-(4-nitrophenyl)pent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 170596504 |
| Molecular Formula | C30H27N5O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-[3-[4-[[(Z,2E)-2-ethylidene-3-(4-nitrophenyl)pent-3-enoyl]amino]phenyl]-1-methylpyrazol-5-yl]benzamide |
| SMILES | C/C=C(C(=C/C)\C(=O)Nc1ccc(-c2cc(NC(=O)c3ccccc3)n(C)n2)cc1)/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H27N5O4/c1-4-25(20-13-17-24(18-14-20)35(38)39)26(5-2)30(37)31-23-15-11-21(12-16-23)27-19-28(34(3)33-27)32-29(36)22-9-7-6-8-10-22/h4-19H,1-3H3,(H,31,37)(H,32,36)/b25-4-,26-5+ |
| InChIKey | LASABQWFFHJFIB-WNSGTPROSA-N |
| XLogP | 6.24 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|