C22H18ClFN4O2 — CID 170413097
N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1-methylpyrazol-5-yl]-2-fluorobenzamide (PubChem CID 170413097) has the molecular formula C22H18ClFN4O2 and a molecular weight of 424.86 g/mol. Its IUPAC name is N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1-methylpyrazol-5-yl]-2-fluorobenzamide.
| Compound Name | N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1-methylpyrazol-5-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 170413097 |
| Molecular Formula | C22H18ClFN4O2 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1-methylpyrazol-5-yl]-2-fluorobenzamide |
| SMILES | C=C(Cl)C(=C)C(=O)Nc1ccc(-c2cc(NC(=O)c3ccccc3F)n(C)n2)cc1 |
| InChI | InChI=1S/C22H18ClFN4O2/c1-13(14(2)23)21(29)25-16-10-8-15(9-11-16)19-12-20(28(3)27-19)26-22(30)17-6-4-5-7-18(17)24/h4-12H,1-2H2,3H3,(H,25,29)(H,26,30) |
| InChIKey | ORLGKXAMBXSRPX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|