C26H20N7O2+ — CID 176857977
[2-[[4-[5-[(3-ethynylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]imino-iminoazanium (PubChem CID 176857977) has the molecular formula C26H20N7O2+ and a molecular weight of 462.49 g/mol. Its IUPAC name is [2-[[4-[5-[(3-ethynylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]imino-iminoazanium.
| Compound Name | [2-[[4-[5-[(3-ethynylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]imino-iminoazanium |
|---|---|
| PubChem CID | 176857977 |
| Molecular Formula | C26H20N7O2+ |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [2-[[4-[5-[(3-ethynylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]imino-iminoazanium |
| SMILES | C#Cc1cccc(C(=O)Nc2cc(-c3ccc(NC(=O)c4ccccc4N=[N+]=N)cc3)nn2C)c1 |
| InChI | InChI=1S/C26H19N7O2/c1-3-17-7-6-8-19(15-17)25(34)29-24-16-23(31-33(24)2)18-11-13-20(14-12-18)28-26(35)21-9-4-5-10-22(21)30-32-27/h1,4-16H,2H3,(H2-,27,28,29,30,31,34,35)/p+1 |
| InChIKey | OFPZRXACYUAMBO-UHFFFAOYSA-O |
| XLogP | 4.75 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|