C35H32N4O4 — CID 176857965
N-[4-[5-[(3-benzoylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]-2-(propoxymethyl)benzamide (PubChem CID 176857965) has the molecular formula C35H32N4O4 and a molecular weight of 572.67 g/mol. Its IUPAC name is N-[4-[5-[(3-benzoylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]-2-(propoxymethyl)benzamide.
| Compound Name | N-[4-[5-[(3-benzoylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]-2-(propoxymethyl)benzamide |
|---|---|
| PubChem CID | 176857965 |
| Molecular Formula | C35H32N4O4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | N-[4-[5-[(3-benzoylbenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]-2-(propoxymethyl)benzamide |
| SMILES | CCCOCc1ccccc1C(=O)Nc1ccc(-c2cc(NC(=O)c3cccc(C(=O)c4ccccc4)c3)n(C)n2)cc1 |
| InChI | InChI=1S/C35H32N4O4/c1-3-20-43-23-28-12-7-8-15-30(28)35(42)36-29-18-16-24(17-19-29)31-22-32(39(2)38-31)37-34(41)27-14-9-13-26(21-27)33(40)25-10-5-4-6-11-25/h4-19,21-22H,3,20,23H2,1-2H3,(H,36,42)(H,37,41) |
| InChIKey | AROGYNIGSYBTSA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|