C33H34N8O6 — CID 170346170
2-[2-[4-[[2-[[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]carbamoyl]phenyl]methoxymethyl]triazol-1-yl]ethoxy]ethylcarbamic acid (PubChem CID 170346170) has the molecular formula C33H34N8O6 and a molecular weight of 638.69 g/mol. Its IUPAC name is 2-[2-[4-[[2-[[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]carbamoyl]phenyl]methoxymethyl]triazol-1-yl]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[4-[[2-[[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]carbamoyl]phenyl]methoxymethyl]triazol-1-yl]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 170346170 |
| Molecular Formula | C33H34N8O6 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.26 |
| IUPAC Name | 2-[2-[4-[[2-[[4-(5-benzamido-1-methylpyrazol-3-yl)phenyl]carbamoyl]phenyl]methoxymethyl]triazol-1-yl]ethoxy]ethylcarbamic acid |
| SMILES | Cn1nc(-c2ccc(NC(=O)c3ccccc3COCc3cn(CCOCCNC(=O)O)nn3)cc2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H34N8O6/c1-40-30(36-31(42)24-7-3-2-4-8-24)19-29(38-40)23-11-13-26(14-12-23)35-32(43)28-10-6-5-9-25(28)21-47-22-27-20-41(39-37-27)16-18-46-17-15-34-33(44)45/h2-14,19-20,34H,15-18,21-22H2,1H3,(H,35,43)(H,36,42)(H,44,45) |
| InChIKey | QOHMBBAXMKTJAD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 174.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|