C32H34ClN5O5 — CID 170596530
tert-butyl N-[2-[[2-[[4-[5-[(2-chlorobenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]methoxy]ethyl]carbamate (PubChem CID 170596530) has the molecular formula C32H34ClN5O5 and a molecular weight of 604.11 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[[4-[5-[(2-chlorobenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]methoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[[4-[5-[(2-chlorobenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170596530 |
| Molecular Formula | C32H34ClN5O5 |
| Molecular Weight | 604.11 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | tert-butyl N-[2-[[2-[[4-[5-[(2-chlorobenzoyl)amino]-1-methylpyrazol-3-yl]phenyl]carbamoyl]phenyl]methoxy]ethyl]carbamate |
| SMILES | Cn1nc(-c2ccc(NC(=O)c3ccccc3COCCNC(=O)OC(C)(C)C)cc2)cc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C32H34ClN5O5/c1-32(2,3)43-31(41)34-17-18-42-20-22-9-5-6-10-24(22)29(39)35-23-15-13-21(14-16-23)27-19-28(38(4)37-27)36-30(40)25-11-7-8-12-26(25)33/h5-16,19H,17-18,20H2,1-4H3,(H,34,41)(H,35,39)(H,36,40) |
| InChIKey | JGUHYSPBBJTTDF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.11 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|