C26H28ClN3O2 — CID 176857954
2-chloro-N-[4-[5-(2-cycloheptyl-2-oxoethyl)-1-methylpyrazol-3-yl]phenyl]benzamide (PubChem CID 176857954) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is 2-chloro-N-[4-[5-(2-cycloheptyl-2-oxoethyl)-1-methylpyrazol-3-yl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[5-(2-cycloheptyl-2-oxoethyl)-1-methylpyrazol-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 176857954 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-chloro-N-[4-[5-(2-cycloheptyl-2-oxoethyl)-1-methylpyrazol-3-yl]phenyl]benzamide |
| SMILES | Cn1nc(-c2ccc(NC(=O)c3ccccc3Cl)cc2)cc1CC(=O)C1CCCCCC1 |
| InChI | InChI=1S/C26H28ClN3O2/c1-30-21(17-25(31)19-8-4-2-3-5-9-19)16-24(29-30)18-12-14-20(15-13-18)28-26(32)22-10-6-7-11-23(22)27/h6-7,10-16,19H,2-5,8-9,17H2,1H3,(H,28,32) |
| InChIKey | LATDXSUUKXOWJO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |