C32H25ClN8O6 — CID 175958554
2-chloro-N-[4-[1-methyl-5-[[3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]benzoyl]amino]pyrazol-3-yl]phenyl]benzamide (PubChem CID 175958554) has the molecular formula C32H25ClN8O6 and a molecular weight of 653.06 g/mol. Its IUPAC name is 2-chloro-N-[4-[1-methyl-5-[[3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]benzoyl]amino]pyrazol-3-yl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[1-methyl-5-[[3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]benzoyl]amino]pyrazol-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 175958554 |
| Molecular Formula | C32H25ClN8O6 |
| Molecular Weight | 653.06 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 2-chloro-N-[4-[1-methyl-5-[[3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethoxy]benzoyl]amino]pyrazol-3-yl]phenyl]benzamide |
| SMILES | Cn1nc(-c2ccc(NC(=O)c3ccccc3Cl)cc2)cc1NC(=O)c1cccc(OCCNc2ccc([N+](=O)[O-])c3nonc23)c1 |
| InChI | InChI=1S/C32H25ClN8O6/c1-40-28(18-26(37-40)19-9-11-21(12-10-19)35-32(43)23-7-2-3-8-24(23)33)36-31(42)20-5-4-6-22(17-20)46-16-15-34-25-13-14-27(41(44)45)30-29(25)38-47-39-30/h2-14,17-18,34H,15-16H2,1H3,(H,35,43)(H,36,42) |
| InChIKey | FRHVSGNCKOSHDE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 179.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.06 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|