C9H8N4O4 — CID 89125533
1-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propan-2-one (PubChem CID 89125533) has the molecular formula C9H8N4O4 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propan-2-one.
| Compound Name | 1-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propan-2-one |
|---|---|
| PubChem CID | 89125533 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propan-2-one |
| SMILES | CC(=O)CNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C9H8N4O4/c1-5(14)4-10-6-2-3-7(13(15)16)9-8(6)11-17-12-9/h2-3,10H,4H2,1H3 |
| InChIKey | SUSPLJQVAOCSES-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|