C8H5ClN4O4 — CID 177471219
2-chloro-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetamide (PubChem CID 177471219) has the molecular formula C8H5ClN4O4 and a molecular weight of 256.61 g/mol. Its IUPAC name is 2-chloro-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetamide.
| Compound Name | 2-chloro-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetamide |
|---|---|
| PubChem CID | 177471219 |
| Molecular Formula | C8H5ClN4O4 |
| Molecular Weight | 256.61 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 2-chloro-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)acetamide |
| SMILES | O=C(CCl)Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C8H5ClN4O4/c9-3-6(14)10-4-1-2-5(13(15)16)8-7(4)11-17-12-8/h1-2H,3H2,(H,10,14) |
| InChIKey | QCTAOVXZDCZPBF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.61 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|