C6H4N4O3Te — CID 174701841
N-(4-nitro-2,1,3-benzoxadiazol-7-yl)tellurohydroxylamine (PubChem CID 174701841) has the molecular formula C6H4N4O3Te and a molecular weight of 307.72 g/mol. Its IUPAC name is N-(4-nitro-2,1,3-benzoxadiazol-7-yl)tellurohydroxylamine.
| Compound Name | N-(4-nitro-2,1,3-benzoxadiazol-7-yl)tellurohydroxylamine |
|---|---|
| PubChem CID | 174701841 |
| Molecular Formula | C6H4N4O3Te |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 309.93 |
| IUPAC Name | N-(4-nitro-2,1,3-benzoxadiazol-7-yl)tellurohydroxylamine |
| SMILES | O=[N+]([O-])c1ccc(N[TeH])c2nonc12 |
| InChI | InChI=1S/C6H4N4O3Te/c11-10(12)4-2-1-3(9-14)5-6(4)8-13-7-5/h1-2,9,14H |
| InChIKey | VHNDNSSHHWUBGM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|