C6H4N4O6S — CID 23370852
(4-nitro-2,1,3-benzoxadiazol-7-yl)sulfamic acid (PubChem CID 23370852) has the molecular formula C6H4N4O6S and a molecular weight of 260.19 g/mol. Its IUPAC name is (4-nitro-2,1,3-benzoxadiazol-7-yl)sulfamic acid.
| Compound Name | (4-nitro-2,1,3-benzoxadiazol-7-yl)sulfamic acid |
|---|---|
| PubChem CID | 23370852 |
| Molecular Formula | C6H4N4O6S |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | (4-nitro-2,1,3-benzoxadiazol-7-yl)sulfamic acid |
| SMILES | O=[N+]([O-])c1ccc(NS(=O)(=O)O)c2nonc12 |
| InChI | InChI=1S/C6H4N4O6S/c11-10(12)4-2-1-3(9-17(13,14)15)5-6(4)8-16-7-5/h1-2,9H,(H,13,14,15) |
| InChIKey | NSCFHFLGOKUBIY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|