C13H8N4O5 — CID 2836605
2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoic acid (PubChem CID 2836605) has the molecular formula C13H8N4O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoic acid.
| Compound Name | 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 2836605 |
| Molecular Formula | C13H8N4O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C13H8N4O5/c18-13(19)7-3-1-2-4-8(7)14-9-5-6-10(17(20)21)12-11(9)15-22-16-12/h1-6,14H,(H,18,19) |
| InChIKey | OQGYGSMIHWVJIQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|