About 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde
2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde (PubChem CID 90896022) has the molecular formula C14H10N4O4
and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde |
| PubChem CID | 90896022 |
| Molecular Formula | C14H10N4O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde |
| SMILES | O=CCc1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C14H10N4O4/c19-8-7-9-1-3-10(4-2-9)15-11-5-6-12(18(20)21)14-13(11)16-22-17-14/h1-6,8,15H,7H2 |
| InChIKey | PNCKCNYABXAATC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde?
The IUPAC name of 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde (CID 90896022) is 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde.
What is the SMILES notation for 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde?
The canonical SMILES for 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde is O=CCc1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1.
What is the InChIKey of 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde?
The InChIKey is PNCKCNYABXAATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O4/c19-8-7-9-1-3-10(4-2-9)15-11-5-6-12(18(20)21)14-13(11)16-22-17-14/h1-6,8,15H,7H2.
What are the key properties of 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde?
2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde has a molecular weight of 298.26 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]acetaldehyde is sourced from PubChem (CID 90896022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).