About 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol
2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol (PubChem CID 22706666) has the molecular formula C14H13N5O4
and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol.
Molecular Properties
| Compound Name | 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol |
| PubChem CID | 22706666 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol |
| SMILES | Nc1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1CCO |
| InChI | InChI=1S/C14H13N5O4/c15-10-2-1-9(7-8(10)5-6-20)16-11-3-4-12(19(21)22)14-13(11)17-23-18-14/h1-4,7,16,20H,5-6,15H2 |
| InChIKey | KHZWGJVBHBEOJS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol?
The IUPAC name of 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol (CID 22706666) is 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol.
What is the SMILES notation for 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol?
The canonical SMILES for 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol is Nc1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1CCO.
What is the InChIKey of 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol?
The InChIKey is KHZWGJVBHBEOJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5O4/c15-10-2-1-9(7-8(10)5-6-20)16-11-3-4-12(19(21)22)14-13(11)17-23-18-14/h1-4,7,16,20H,5-6,15H2.
What are the key properties of 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol?
2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol has a molecular weight of 315.29 g/mol, XLogP of 1.99, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol is sourced from PubChem (CID 22706666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).