C14H13N5O4 — CID 22706666
2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol (PubChem CID 22706666) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol.
| Compound Name | 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 22706666 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[2-amino-5-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]ethanol |
| SMILES | Nc1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1CCO |
| InChI | InChI=1S/C14H13N5O4/c15-10-2-1-9(7-8(10)5-6-20)16-11-3-4-12(19(21)22)14-13(11)17-23-18-14/h1-4,7,16,20H,5-6,15H2 |
| InChIKey | KHZWGJVBHBEOJS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|