C8H8N4O3 — CID 13452090
N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 13452090) has the molecular formula C8H8N4O3 and a molecular weight of 208.18 g/mol. Its IUPAC name is N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 13452090 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | N-ethyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C8H8N4O3/c1-2-9-5-3-4-6(12(13)14)8-7(5)10-15-11-8/h3-4,9H,2H2,1H3 |
| InChIKey | AUOXSMQGNROUMV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|