C13H20N5O3+ — CID 175375826
trimethyl-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-yl]azanium (PubChem CID 175375826) has the molecular formula C13H20N5O3+ and a molecular weight of 294.34 g/mol. Its IUPAC name is trimethyl-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-yl]azanium.
| Compound Name | trimethyl-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-yl]azanium |
|---|---|
| PubChem CID | 175375826 |
| Molecular Formula | C13H20N5O3+ |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | trimethyl-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-yl]azanium |
| SMILES | CC(CCNc1ccc([N+](=O)[O-])c2nonc12)[N+](C)(C)C |
| InChI | InChI=1S/C13H20N5O3/c1-9(18(2,3)4)7-8-14-10-5-6-11(17(19)20)13-12(10)15-21-16-13/h5-6,9,14H,7-8H2,1-4H3/q+1 |
| InChIKey | ZKGDALFWRURCHK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|