C9H10N4O4S — CID 115631520
N-(2-methylsulfinylethyl)-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 115631520) has the molecular formula C9H10N4O4S and a molecular weight of 270.27 g/mol. Its IUPAC name is N-(2-methylsulfinylethyl)-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-(2-methylsulfinylethyl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 115631520 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | N-(2-methylsulfinylethyl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CS(=O)CCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C9H10N4O4S/c1-18(16)5-4-10-6-2-3-7(13(14)15)9-8(6)11-17-12-9/h2-3,10H,4-5H2,1H3 |
| InChIKey | YCMIJHDKKWDEBX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|