C10H13N5O3 — CID 55228961
1-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)butane-1,2-diamine (PubChem CID 55228961) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)butane-1,2-diamine.
| Compound Name | 1-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 55228961 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-N-(4-nitro-2,1,3-benzoxadiazol-7-yl)butane-1,2-diamine |
| SMILES | CCC(N)CNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C10H13N5O3/c1-2-6(11)5-12-7-3-4-8(15(16)17)10-9(7)13-18-14-10/h3-4,6,12H,2,5,11H2,1H3 |
| InChIKey | XXROOISZXAOOMI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|