C10H10IN5O4 — CID 90795429
3-amino-1-iodo-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-one (PubChem CID 90795429) has the molecular formula C10H10IN5O4 and a molecular weight of 391.13 g/mol. Its IUPAC name is 3-amino-1-iodo-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-one.
| Compound Name | 3-amino-1-iodo-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-one |
|---|---|
| PubChem CID | 90795429 |
| Molecular Formula | C10H10IN5O4 |
| Molecular Weight | 391.13 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 3-amino-1-iodo-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butan-2-one |
| SMILES | NC(CNc1ccc([N+](=O)[O-])c2nonc12)C(=O)CI |
| InChI | InChI=1S/C10H10IN5O4/c11-3-8(17)5(12)4-13-6-1-2-7(16(18)19)10-9(6)14-20-15-10/h1-2,5,13H,3-4,12H2 |
| InChIKey | MMYXTPWLAIDJSY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.13 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|