C9H9N5O4Se — CID 155694543
2-amino-3-[(4-nitro-2,1,3-benzoselenadiazol-7-yl)amino]propanoic acid (PubChem CID 155694543) has the molecular formula C9H9N5O4Se and a molecular weight of 330.16 g/mol. Its IUPAC name is 2-amino-3-[(4-nitro-2,1,3-benzoselenadiazol-7-yl)amino]propanoic acid.
| Compound Name | 2-amino-3-[(4-nitro-2,1,3-benzoselenadiazol-7-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 155694543 |
| Molecular Formula | C9H9N5O4Se |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-amino-3-[(4-nitro-2,1,3-benzoselenadiazol-7-yl)amino]propanoic acid |
| SMILES | NC(CNc1ccc([N+](=O)[O-])c2n[se]nc12)C(=O)O |
| InChI | InChI=1S/C9H9N5O4Se/c10-4(9(15)16)3-11-5-1-2-6(14(17)18)8-7(5)12-19-13-8/h1-2,4,11H,3,10H2,(H,15,16) |
| InChIKey | BNULWKPGSNFLDB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|