C12H17N3O4 — CID 67821509
2-amino-6-(2-nitroanilino)hexanoic acid (PubChem CID 67821509) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-amino-6-(2-nitroanilino)hexanoic acid.
| Compound Name | 2-amino-6-(2-nitroanilino)hexanoic acid |
|---|---|
| PubChem CID | 67821509 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-amino-6-(2-nitroanilino)hexanoic acid |
| SMILES | NC(CCCCNc1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c13-9(12(16)17)5-3-4-8-14-10-6-1-2-7-11(10)15(18)19/h1-2,6-7,9,14H,3-5,8,13H2,(H,16,17) |
| InChIKey | SVGGWJUIVRNBQY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|