C18H20N6O12S — CID 88921694
(2S)-2,6-diaminohexanoic acid;1-(2,3-dinitrophenyl)sulfonyl-2,3-dinitrobenzene (PubChem CID 88921694) has the molecular formula C18H20N6O12S and a molecular weight of 544.46 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;1-(2,3-dinitrophenyl)sulfonyl-2,3-dinitrobenzene.
| Compound Name | (2S)-2,6-diaminohexanoic acid;1-(2,3-dinitrophenyl)sulfonyl-2,3-dinitrobenzene |
|---|---|
| PubChem CID | 88921694 |
| Molecular Formula | C18H20N6O12S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;1-(2,3-dinitrophenyl)sulfonyl-2,3-dinitrobenzene |
| SMILES | NCCCC[C@H](N)C(=O)O.O=[N+]([O-])c1cccc(S(=O)(=O)c2cccc([N+](=O)[O-])c2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H6N4O10S.C6H14N2O2/c17-13(18)7-3-1-5-9(11(7)15(21)22)27(25,26)10-6-2-4-8(14(19)20)12(10)16(23)24;7-4-2-1-3-5(8)6(9)10/h1-6H;5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | GPENRYCWWXCZBY-ZSCHJXSPSA-N |
| XLogP | 1.68 |
| TPSA | 296.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|