C12H21N3O5S — CID 88844713
4-aminobenzenesulfonic acid;(2R)-2,6-diaminohexanoic acid (PubChem CID 88844713) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid;(2R)-2,6-diaminohexanoic acid.
| Compound Name | 4-aminobenzenesulfonic acid;(2R)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 88844713 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-aminobenzenesulfonic acid;(2R)-2,6-diaminohexanoic acid |
| SMILES | NCCCC[C@@H](N)C(=O)O.Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C6H14N2O2.C6H7NO3S/c7-4-2-1-3-5(8)6(9)10;7-5-1-3-6(4-2-5)11(8,9)10/h5H,1-4,7-8H2,(H,9,10);1-4H,7H2,(H,8,9,10)/t5-;/m1./s1 |
| InChIKey | OXDWBEVSRWRLEZ-NUBCRITNSA-N |
| XLogP | 0.04 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|