C25H33N5O2 — CID 69036187
4-[bis(4-aminophenyl)methyl]aniline;(2S)-2,6-diaminohexanoic acid (PubChem CID 69036187) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[bis(4-aminophenyl)methyl]aniline;(2S)-2,6-diaminohexanoic acid.
| Compound Name | 4-[bis(4-aminophenyl)methyl]aniline;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 69036187 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 4-[bis(4-aminophenyl)methyl]aniline;(2S)-2,6-diaminohexanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.Nc1ccc(C(c2ccc(N)cc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C19H19N3.C6H14N2O2/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;7-4-2-1-3-5(8)6(9)10/h1-12,19H,20-22H2;5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | IGONMLXYSSKKQZ-ZSCHJXSPSA-N |
| XLogP | 3.14 |
| TPSA | 167.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|