C20H26N4O4 — CID 71442066
N,N'-bis(2-nitrophenyl)octane-1,8-diamine (PubChem CID 71442066) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N,N'-bis(2-nitrophenyl)octane-1,8-diamine.
| Compound Name | N,N'-bis(2-nitrophenyl)octane-1,8-diamine |
|---|---|
| PubChem CID | 71442066 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N,N'-bis(2-nitrophenyl)octane-1,8-diamine |
| SMILES | O=[N+]([O-])c1ccccc1NCCCCCCCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N4O4/c25-23(26)19-13-7-5-11-17(19)21-15-9-3-1-2-4-10-16-22-18-12-6-8-14-20(18)24(27)28/h5-8,11-14,21-22H,1-4,9-10,15-16H2 |
| InChIKey | JJAYTVNXQGPXPE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|