About 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol
1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol (PubChem CID 69484807) has the molecular formula C13H23N3O5
and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol.
Molecular Properties
| Compound Name | 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol |
| PubChem CID | 69484807 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol |
| SMILES | CC(O)NC(C)O.O=[N+]([O-])c1ccccc1NCCCO |
| InChI | InChI=1S/C9H12N2O3.C4H11NO2/c12-7-3-6-10-8-4-1-2-5-9(8)11(13)14;1-3(6)5-4(2)7/h1-2,4-5,10,12H,3,6-7H2;3-7H,1-2H3 |
| InChIKey | YYCJMCHYOIQDCA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol?
The IUPAC name of 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol (CID 69484807) is 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol.
What is the SMILES notation for 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol?
The canonical SMILES for 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol is CC(O)NC(C)O.O=[N+]([O-])c1ccccc1NCCCO.
What is the InChIKey of 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol?
The InChIKey is YYCJMCHYOIQDCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3.C4H11NO2/c12-7-3-6-10-8-4-1-2-5-9(8)11(13)14;1-3(6)5-4(2)7/h1-2,4-5,10,12H,3,6-7H2;3-7H,1-2H3.
What are the key properties of 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol?
1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol has a molecular weight of 301.34 g/mol, XLogP of 0.64, 7 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxyethylamino)ethanol;3-(2-nitroanilino)propan-1-ol is sourced from PubChem (CID 69484807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).