C11H16N2O3 — CID 163261578
3-(4,5-dimethyl-2-nitroanilino)propan-1-ol (PubChem CID 163261578) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(4,5-dimethyl-2-nitroanilino)propan-1-ol.
| Compound Name | 3-(4,5-dimethyl-2-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 163261578 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-(4,5-dimethyl-2-nitroanilino)propan-1-ol |
| SMILES | Cc1cc(NCCCO)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C11H16N2O3/c1-8-6-10(12-4-3-5-14)11(13(15)16)7-9(8)2/h6-7,12,14H,3-5H2,1-2H3 |
| InChIKey | KKCUUBXRTGIANB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|